C17H27NS — CID 79955328
N-(4-butylphenyl)-5,5-dimethylthian-3-amine (PubChem CID 79955328) has the molecular formula C17H27NS and a molecular weight of 277.48 g/mol. Its IUPAC name is N-(4-butylphenyl)-5,5-dimethylthian-3-amine.
| Compound Name | N-(4-butylphenyl)-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79955328 |
| Molecular Formula | C17H27NS |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N-(4-butylphenyl)-5,5-dimethylthian-3-amine |
| SMILES | CCCCc1ccc(NC2CSCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H27NS/c1-4-5-6-14-7-9-15(10-8-14)18-16-11-17(2,3)13-19-12-16/h7-10,16,18H,4-6,11-13H2,1-3H3 |
| InChIKey | XTSUEVYTMMZGBM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |