C17H26N2OS — CID 79953478
N-[4-[(5,5-dimethylthian-3-yl)amino]phenyl]-2-methylpropanamide (PubChem CID 79953478) has the molecular formula C17H26N2OS and a molecular weight of 306.48 g/mol. Its IUPAC name is N-[4-[(5,5-dimethylthian-3-yl)amino]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[(5,5-dimethylthian-3-yl)amino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 79953478 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | N-[4-[(5,5-dimethylthian-3-yl)amino]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(NC2CSCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H26N2OS/c1-12(2)16(20)19-14-7-5-13(6-8-14)18-15-9-17(3,4)11-21-10-15/h5-8,12,15,18H,9-11H2,1-4H3,(H,19,20) |
| InChIKey | MHMVFCCPLHEKIL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |