C15H21FN2OS — CID 79956147
N-[3-[(5,5-dimethylthian-3-yl)amino]-4-fluorophenyl]acetamide (PubChem CID 79956147) has the molecular formula C15H21FN2OS and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[3-[(5,5-dimethylthian-3-yl)amino]-4-fluorophenyl]acetamide.
| Compound Name | N-[3-[(5,5-dimethylthian-3-yl)amino]-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 79956147 |
| Molecular Formula | C15H21FN2OS |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[3-[(5,5-dimethylthian-3-yl)amino]-4-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(NC2CSCC(C)(C)C2)c1 |
| InChI | InChI=1S/C15H21FN2OS/c1-10(19)17-11-4-5-13(16)14(6-11)18-12-7-15(2,3)9-20-8-12/h4-6,12,18H,7-9H2,1-3H3,(H,17,19) |
| InChIKey | BKJJVLIBTMSSNN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |