About N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine
N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine (PubChem CID 79956405) has the molecular formula C13H17Cl2NS
and a molecular weight of 290.26 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine.
Molecular Properties
| Compound Name | N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine |
| PubChem CID | 79956405 |
| Molecular Formula | C13H17Cl2NS |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(Nc2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C13H17Cl2NS/c1-13(2)6-9(7-17-8-13)16-11-5-3-4-10(14)12(11)15/h3-5,9,16H,6-8H2,1-2H3 |
| InChIKey | CRAQMJPBAZOSKJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine?
The IUPAC name of N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine (CID 79956405) is N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine.
What is the SMILES notation for N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine?
The canonical SMILES for N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine is CC1(C)CSCC(Nc2cccc(Cl)c2Cl)C1.
What is the InChIKey of N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine?
The InChIKey is CRAQMJPBAZOSKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2NS/c1-13(2)6-9(7-17-8-13)16-11-5-3-4-10(14)12(11)15/h3-5,9,16H,6-8H2,1-2H3.
What are the key properties of N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine?
N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine has a molecular weight of 290.26 g/mol, XLogP of 4.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dichlorophenyl)-5,5-dimethylthian-3-amine is sourced from PubChem (CID 79956405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).