C15H20N4S — CID 79958612
5,5-dimethyl-N-[2-(1,2,4-triazol-1-yl)phenyl]thian-3-amine (PubChem CID 79958612) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 5,5-dimethyl-N-[2-(1,2,4-triazol-1-yl)phenyl]thian-3-amine.
| Compound Name | 5,5-dimethyl-N-[2-(1,2,4-triazol-1-yl)phenyl]thian-3-amine |
|---|---|
| PubChem CID | 79958612 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5,5-dimethyl-N-[2-(1,2,4-triazol-1-yl)phenyl]thian-3-amine |
| SMILES | CC1(C)CSCC(Nc2ccccc2-n2cncn2)C1 |
| InChI | InChI=1S/C15H20N4S/c1-15(2)7-12(8-20-9-15)18-13-5-3-4-6-14(13)19-11-16-10-17-19/h3-6,10-12,18H,7-9H2,1-2H3 |
| InChIKey | HRUUXYNITHGSIR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |