C13H16N4S — CID 95135165
(3R)-N-[[2-(1,2,4-triazol-1-yl)phenyl]methyl]thiolan-3-amine (PubChem CID 95135165) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is (3R)-N-[[2-(1,2,4-triazol-1-yl)phenyl]methyl]thiolan-3-amine.
| Compound Name | (3R)-N-[[2-(1,2,4-triazol-1-yl)phenyl]methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 95135165 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (3R)-N-[[2-(1,2,4-triazol-1-yl)phenyl]methyl]thiolan-3-amine |
| SMILES | c1ccc(-n2cncn2)c(CN[C@@H]2CCSC2)c1 |
| InChI | InChI=1S/C13H16N4S/c1-2-4-13(17-10-14-9-16-17)11(3-1)7-15-12-5-6-18-8-12/h1-4,9-10,12,15H,5-8H2/t12-/m1/s1 |
| InChIKey | UVUYNXBGKLEERC-GFCCVEGCSA-N |
| XLogP | 1.86 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |