C14H17N3S — CID 61168288
N-[(2-pyrazol-1-ylphenyl)methyl]thiolan-3-amine (PubChem CID 61168288) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is N-[(2-pyrazol-1-ylphenyl)methyl]thiolan-3-amine.
| Compound Name | N-[(2-pyrazol-1-ylphenyl)methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 61168288 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[(2-pyrazol-1-ylphenyl)methyl]thiolan-3-amine |
| SMILES | c1ccc(-n2cccn2)c(CNC2CCSC2)c1 |
| InChI | InChI=1S/C14H17N3S/c1-2-5-14(17-8-3-7-16-17)12(4-1)10-15-13-6-9-18-11-13/h1-5,7-8,13,15H,6,9-11H2 |
| InChIKey | ORBJXIQOLODBPO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |