C22H26N4 — CID 95789191
(3S)-1-[(1S)-1-phenylethyl]-N-[(2-pyrazol-1-ylphenyl)methyl]pyrrolidin-3-amine (PubChem CID 95789191) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is (3S)-1-[(1S)-1-phenylethyl]-N-[(2-pyrazol-1-ylphenyl)methyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-[(1S)-1-phenylethyl]-N-[(2-pyrazol-1-ylphenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 95789191 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (3S)-1-[(1S)-1-phenylethyl]-N-[(2-pyrazol-1-ylphenyl)methyl]pyrrolidin-3-amine |
| SMILES | C[C@@H](c1ccccc1)N1CC[C@H](NCc2ccccc2-n2cccn2)C1 |
| InChI | InChI=1S/C22H26N4/c1-18(19-8-3-2-4-9-19)25-15-12-21(17-25)23-16-20-10-5-6-11-22(20)26-14-7-13-24-26/h2-11,13-14,18,21,23H,12,15-17H2,1H3/t18-,21-/m0/s1 |
| InChIKey | APIBAPAPFRNTGG-RXVVDRJESA-N |
| XLogP | 3.80 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |