C15H19N3OS — CID 95149374
(3R)-N-[[1-(2-methoxyphenyl)pyrazol-4-yl]methyl]thiolan-3-amine (PubChem CID 95149374) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is (3R)-N-[[1-(2-methoxyphenyl)pyrazol-4-yl]methyl]thiolan-3-amine.
| Compound Name | (3R)-N-[[1-(2-methoxyphenyl)pyrazol-4-yl]methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 95149374 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (3R)-N-[[1-(2-methoxyphenyl)pyrazol-4-yl]methyl]thiolan-3-amine |
| SMILES | COc1ccccc1-n1cc(CN[C@@H]2CCSC2)cn1 |
| InChI | InChI=1S/C15H19N3OS/c1-19-15-5-3-2-4-14(15)18-10-12(9-17-18)8-16-13-6-7-20-11-13/h2-5,9-10,13,16H,6-8,11H2,1H3/t13-/m1/s1 |
| InChIKey | YUVZTQRGOWUTTR-CYBMUJFWSA-N |
| XLogP | 2.48 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |