C13H19NO3S — CID 113260995
2,6-dimethoxy-4-[(thiolan-3-ylamino)methyl]phenol (PubChem CID 113260995) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(thiolan-3-ylamino)methyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[(thiolan-3-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 113260995 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2,6-dimethoxy-4-[(thiolan-3-ylamino)methyl]phenol |
| SMILES | COc1cc(CNC2CCSC2)cc(OC)c1O |
| InChI | InChI=1S/C13H19NO3S/c1-16-11-5-9(6-12(17-2)13(11)15)7-14-10-3-4-18-8-10/h5-6,10,14-15H,3-4,7-8H2,1-2H3 |
| InChIKey | QSANITIWYPWHNI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |