C15H17N5O3S — CID 131950435
N-[[1-(2-methoxyphenyl)pyrazol-4-yl]methyl]-1-methylimidazole-4-sulfonamide (PubChem CID 131950435) has the molecular formula C15H17N5O3S and a molecular weight of 347.40 g/mol. Its IUPAC name is N-[[1-(2-methoxyphenyl)pyrazol-4-yl]methyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[[1-(2-methoxyphenyl)pyrazol-4-yl]methyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 131950435 |
| Molecular Formula | C15H17N5O3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[[1-(2-methoxyphenyl)pyrazol-4-yl]methyl]-1-methylimidazole-4-sulfonamide |
| SMILES | COc1ccccc1-n1cc(CNS(=O)(=O)c2cn(C)cn2)cn1 |
| InChI | InChI=1S/C15H17N5O3S/c1-19-10-15(16-11-19)24(21,22)18-8-12-7-17-20(9-12)13-5-3-4-6-14(13)23-2/h3-7,9-11,18H,8H2,1-2H3 |
| InChIKey | KOULNQUZVZCKMM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |