C14H20N4O3S — CID 120583442
N-(4-aminobutyl)-1-(2-methoxyphenyl)pyrazole-4-sulfonamide (PubChem CID 120583442) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is N-(4-aminobutyl)-1-(2-methoxyphenyl)pyrazole-4-sulfonamide.
| Compound Name | N-(4-aminobutyl)-1-(2-methoxyphenyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 120583442 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-(4-aminobutyl)-1-(2-methoxyphenyl)pyrazole-4-sulfonamide |
| SMILES | COc1ccccc1-n1cc(S(=O)(=O)NCCCCN)cn1 |
| InChI | InChI=1S/C14H20N4O3S/c1-21-14-7-3-2-6-13(14)18-11-12(10-16-18)22(19,20)17-9-5-4-8-15/h2-3,6-7,10-11,17H,4-5,8-9,15H2,1H3 |
| InChIKey | MNFMCONBHVIBIV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|