C15H21ClN4O3S — CID 119959400
1-[1-(2-methoxyphenyl)pyrazol-4-yl]sulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119959400) has the molecular formula C15H21ClN4O3S and a molecular weight of 372.88 g/mol. Its IUPAC name is 1-[1-(2-methoxyphenyl)pyrazol-4-yl]sulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-[1-(2-methoxyphenyl)pyrazol-4-yl]sulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119959400 |
| Molecular Formula | C15H21ClN4O3S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-[1-(2-methoxyphenyl)pyrazol-4-yl]sulfonylpiperidin-4-amine;hydrochloride |
| SMILES | COc1ccccc1-n1cc(S(=O)(=O)N2CCC(N)CC2)cn1.Cl |
| InChI | InChI=1S/C15H20N4O3S.ClH/c1-22-15-5-3-2-4-14(15)19-11-13(10-17-19)23(20,21)18-8-6-12(16)7-9-18;/h2-5,10-12H,6-9,16H2,1H3;1H |
| InChIKey | XTTZELLURQYUOH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |