C11H12N4 — CID 103439007
N-cyclopropyl-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 103439007) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is N-cyclopropyl-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-cyclopropyl-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 103439007 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-cyclopropyl-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | c1ccc(-n2cncn2)c(NC2CC2)c1 |
| InChI | InChI=1S/C11H12N4/c1-2-4-11(15-8-12-7-13-15)10(3-1)14-9-5-6-9/h1-4,7-9,14H,5-6H2 |
| InChIKey | AUPYCURQPVLVDJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |