C16H24N4 — CID 43711465
N-octyl-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 43711465) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N-octyl-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-octyl-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 43711465 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N-octyl-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | CCCCCCCCNc1ccccc1-n1cncn1 |
| InChI | InChI=1S/C16H24N4/c1-2-3-4-5-6-9-12-18-15-10-7-8-11-16(15)20-14-17-13-19-20/h7-8,10-11,13-14,18H,2-6,9,12H2,1H3 |
| InChIKey | DWMPTUVFXCYBDO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|