C16H23FN4 — CID 63451897
3-fluoro-N-octyl-4-(1,2,4-triazol-1-yl)aniline (PubChem CID 63451897) has the molecular formula C16H23FN4 and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-fluoro-N-octyl-4-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 3-fluoro-N-octyl-4-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 63451897 |
| Molecular Formula | C16H23FN4 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 3-fluoro-N-octyl-4-(1,2,4-triazol-1-yl)aniline |
| SMILES | CCCCCCCCNc1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C16H23FN4/c1-2-3-4-5-6-7-10-19-14-8-9-16(15(17)11-14)21-13-18-12-20-21/h8-9,11-13,19H,2-7,10H2,1H3 |
| InChIKey | PRSIOILVFKRPTG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|