C16H15FN4 — CID 60933338
3-fluoro-N-(2-phenylethyl)-4-(1,2,4-triazol-1-yl)aniline (PubChem CID 60933338) has the molecular formula C16H15FN4 and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-fluoro-N-(2-phenylethyl)-4-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 3-fluoro-N-(2-phenylethyl)-4-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 60933338 |
| Molecular Formula | C16H15FN4 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-fluoro-N-(2-phenylethyl)-4-(1,2,4-triazol-1-yl)aniline |
| SMILES | Fc1cc(NCCc2ccccc2)ccc1-n1cncn1 |
| InChI | InChI=1S/C16H15FN4/c17-15-10-14(6-7-16(15)21-12-18-11-20-21)19-9-8-13-4-2-1-3-5-13/h1-7,10-12,19H,8-9H2 |
| InChIKey | NCICKYVQVPETGE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |