C15H13ClN4 — CID 43231355
N-benzyl-5-chloro-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 43231355) has the molecular formula C15H13ClN4 and a molecular weight of 284.75 g/mol. Its IUPAC name is N-benzyl-5-chloro-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-benzyl-5-chloro-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 43231355 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-benzyl-5-chloro-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | Clc1ccc(-n2cncn2)c(NCc2ccccc2)c1 |
| InChI | InChI=1S/C15H13ClN4/c16-13-6-7-15(20-11-17-10-19-20)14(8-13)18-9-12-4-2-1-3-5-12/h1-8,10-11,18H,9H2 |
| InChIKey | JNOBWOKUYBJCRJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |