C10H11ClN4 — CID 43228690
5-chloro-N-ethyl-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 43228690) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 5-chloro-N-ethyl-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 5-chloro-N-ethyl-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 43228690 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 5-chloro-N-ethyl-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | CCNc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C10H11ClN4/c1-2-13-9-5-8(11)3-4-10(9)15-7-12-6-14-15/h3-7,13H,2H2,1H3 |
| InChIKey | KLUBSYSWOHAXON-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |