C10H10Cl2N4O2S — CID 107650644
2-chloro-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]ethanesulfonamide (PubChem CID 107650644) has the molecular formula C10H10Cl2N4O2S and a molecular weight of 321.19 g/mol. Its IUPAC name is 2-chloro-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107650644 |
| Molecular Formula | C10H10Cl2N4O2S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-chloro-N-[5-chloro-2-(1,2,4-triazol-1-yl)phenyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCCl)Nc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C10H10Cl2N4O2S/c11-3-4-19(17,18)15-9-5-8(12)1-2-10(9)16-7-13-6-14-16/h1-2,5-7,15H,3-4H2 |
| InChIKey | PVKCQTWTUPNWIZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|