C12H15ClN4O2S — CID 116815655
4-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]butane-1-sulfonamide (PubChem CID 116815655) has the molecular formula C12H15ClN4O2S and a molecular weight of 314.80 g/mol. Its IUPAC name is 4-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]butane-1-sulfonamide.
| Compound Name | 4-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815655 |
| Molecular Formula | C12H15ClN4O2S |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 4-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCCl)Nc1ccccc1-n1cncn1 |
| InChI | InChI=1S/C12H15ClN4O2S/c13-7-3-4-8-20(18,19)16-11-5-1-2-6-12(11)17-10-14-9-15-17/h1-2,5-6,9-10,16H,3-4,7-8H2 |
| InChIKey | ALJVTNMSWMLBGC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|