C14H21ClN2O2S — CID 43654348
3-chloro-N-(2-piperidin-1-ylphenyl)propane-1-sulfonamide (PubChem CID 43654348) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 3-chloro-N-(2-piperidin-1-ylphenyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(2-piperidin-1-ylphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 43654348 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-chloro-N-(2-piperidin-1-ylphenyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C14H21ClN2O2S/c15-9-6-12-20(18,19)16-13-7-2-3-8-14(13)17-10-4-1-5-11-17/h2-3,7-8,16H,1,4-6,9-12H2 |
| InChIKey | JPUYKHOPSORPIO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|