C18H29N3O2S — CID 110400368
N-(2,5-dipyrrolidin-1-ylphenyl)butane-1-sulfonamide (PubChem CID 110400368) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is N-(2,5-dipyrrolidin-1-ylphenyl)butane-1-sulfonamide.
| Compound Name | N-(2,5-dipyrrolidin-1-ylphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 110400368 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-(2,5-dipyrrolidin-1-ylphenyl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1cc(N2CCCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C18H29N3O2S/c1-2-3-14-24(22,23)19-17-15-16(20-10-4-5-11-20)8-9-18(17)21-12-6-7-13-21/h8-9,15,19H,2-7,10-14H2,1H3 |
| InChIKey | ONZAXSKXLYKAKN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|