C18H28N4O — CID 110400361
1-(2,5-dipyrrolidin-1-ylphenyl)-3-propylurea (PubChem CID 110400361) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-(2,5-dipyrrolidin-1-ylphenyl)-3-propylurea.
| Compound Name | 1-(2,5-dipyrrolidin-1-ylphenyl)-3-propylurea |
|---|---|
| PubChem CID | 110400361 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 1-(2,5-dipyrrolidin-1-ylphenyl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1cc(N2CCCC2)ccc1N1CCCC1 |
| InChI | InChI=1S/C18H28N4O/c1-2-9-19-18(23)20-16-14-15(21-10-3-4-11-21)7-8-17(16)22-12-5-6-13-22/h7-8,14H,2-6,9-13H2,1H3,(H2,19,20,23) |
| InChIKey | FOGONTKYEONOOT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|