C20H31N5O2 — CID 50792137
1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-propylurea (PubChem CID 50792137) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-propylurea.
| Compound Name | 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-propylurea |
|---|---|
| PubChem CID | 50792137 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1cc2c(cc1N1CCCCC1)n(CC)c(=O)n2CC |
| InChI | InChI=1S/C20H31N5O2/c1-4-10-21-19(26)22-15-13-17-18(25(6-3)20(27)24(17)5-2)14-16(15)23-11-8-7-9-12-23/h13-14H,4-12H2,1-3H3,(H2,21,22,26) |
| InChIKey | UKDOJXFEVGJILT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |