C21H33N5O2 — CID 50792101
1-butan-2-yl-3-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)urea (PubChem CID 50792101) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-butan-2-yl-3-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)urea.
| Compound Name | 1-butan-2-yl-3-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)urea |
|---|---|
| PubChem CID | 50792101 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 1-butan-2-yl-3-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)urea |
| SMILES | CCC(C)NC(=O)Nc1cc2c(cc1N1CCCCC1)n(CC)c(=O)n2CC |
| InChI | InChI=1S/C21H33N5O2/c1-5-15(4)22-20(27)23-16-13-18-19(26(7-3)21(28)25(18)6-2)14-17(16)24-11-9-8-10-12-24/h13-15H,5-12H2,1-4H3,(H2,22,23,27) |
| InChIKey | OIOBNWAMQCQFJO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |