C24H31N5O2 — CID 50792175
1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-(3-methylphenyl)urea (PubChem CID 50792175) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-(3-methylphenyl)urea.
| Compound Name | 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 50792175 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-(3-methylphenyl)urea |
| SMILES | CCn1c(=O)n(CC)c2cc(N3CCCCC3)c(NC(=O)Nc3cccc(C)c3)cc21 |
| InChI | InChI=1S/C24H31N5O2/c1-4-28-21-15-19(26-23(30)25-18-11-9-10-17(3)14-18)20(27-12-7-6-8-13-27)16-22(21)29(5-2)24(28)31/h9-11,14-16H,4-8,12-13H2,1-3H3,(H2,25,26,30) |
| InChIKey | WJUMBILLOZWFSR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |