C25H33N5O3 — CID 46249182
1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-(4-ethoxyphenyl)urea (PubChem CID 46249182) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 46249182 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 1-(1,3-diethyl-2-oxo-6-piperidin-1-ylbenzimidazol-5-yl)-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)Nc2cc3c(cc2N2CCCCC2)n(CC)c(=O)n3CC)cc1 |
| InChI | InChI=1S/C25H33N5O3/c1-4-29-22-16-20(27-24(31)26-18-10-12-19(13-11-18)33-6-3)21(28-14-8-7-9-15-28)17-23(22)30(5-2)25(29)32/h10-13,16-17H,4-9,14-15H2,1-3H3,(H2,26,27,31) |
| InChIKey | KJGZMXDWCYIYKH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |