C29H34N4O3 — CID 93099771
5-[(4-ethoxyphenyl)carbamoylamino]-N-[(1R)-1-phenylethyl]-2-piperidin-1-ylbenzamide (PubChem CID 93099771) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 5-[(4-ethoxyphenyl)carbamoylamino]-N-[(1R)-1-phenylethyl]-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(4-ethoxyphenyl)carbamoylamino]-N-[(1R)-1-phenylethyl]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 93099771 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 5-[(4-ethoxyphenyl)carbamoylamino]-N-[(1R)-1-phenylethyl]-2-piperidin-1-ylbenzamide |
| SMILES | CCOc1ccc(NC(=O)Nc2ccc(N3CCCCC3)c(C(=O)N[C@H](C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H34N4O3/c1-3-36-25-15-12-23(13-16-25)31-29(35)32-24-14-17-27(33-18-8-5-9-19-33)26(20-24)28(34)30-21(2)22-10-6-4-7-11-22/h4,6-7,10-17,20-21H,3,5,8-9,18-19H2,1-2H3,(H,30,34)(H2,31,32,35)/t21-/m1/s1 |
| InChIKey | WXYZQNBTISKEAU-OAQYLSRUSA-N |
| XLogP | 6.21 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|