C25H33N3O2 — CID 4302250
5-(2,2-dimethylpropanoylamino)-N-(1-phenylethyl)-2-piperidin-1-ylbenzamide (PubChem CID 4302250) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoylamino)-N-(1-phenylethyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-(2,2-dimethylpropanoylamino)-N-(1-phenylethyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4302250 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 5-(2,2-dimethylpropanoylamino)-N-(1-phenylethyl)-2-piperidin-1-ylbenzamide |
| SMILES | CC(NC(=O)c1cc(NC(=O)C(C)(C)C)ccc1N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O2/c1-18(19-11-7-5-8-12-19)26-23(29)21-17-20(27-24(30)25(2,3)4)13-14-22(21)28-15-9-6-10-16-28/h5,7-8,11-14,17-18H,6,9-10,15-16H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | JZCORIBVSCHFBO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|