C16H26N2O3S2 — CID 167701227
N-[methylidene-(3-methylsulfonylpropyl)-oxo-λ6-sulfanyl]-2-piperidin-1-ylaniline (PubChem CID 167701227) has the molecular formula C16H26N2O3S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-[methylidene-(3-methylsulfonylpropyl)-oxo-λ6-sulfanyl]-2-piperidin-1-ylaniline.
| Compound Name | N-[methylidene-(3-methylsulfonylpropyl)-oxo-λ6-sulfanyl]-2-piperidin-1-ylaniline |
|---|---|
| PubChem CID | 167701227 |
| Molecular Formula | C16H26N2O3S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[methylidene-(3-methylsulfonylpropyl)-oxo-λ6-sulfanyl]-2-piperidin-1-ylaniline |
| SMILES | C=S(=O)(CCCS(C)(=O)=O)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C16H26N2O3S2/c1-22(19,13-8-14-23(2,20)21)17-15-9-4-5-10-16(15)18-11-6-3-7-12-18/h4-5,9-10H,1,3,6-8,11-14H2,2H3,(H,17,19) |
| InChIKey | KGTYTQNWLWXDAP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|