C10H12ClF2NO3S — CID 43654163
3-chloro-N-[2-(difluoromethoxy)phenyl]propane-1-sulfonamide (PubChem CID 43654163) has the molecular formula C10H12ClF2NO3S and a molecular weight of 299.73 g/mol. Its IUPAC name is 3-chloro-N-[2-(difluoromethoxy)phenyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[2-(difluoromethoxy)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 43654163 |
| Molecular Formula | C10H12ClF2NO3S |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-chloro-N-[2-(difluoromethoxy)phenyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C10H12ClF2NO3S/c11-6-3-7-18(15,16)14-8-4-1-2-5-9(8)17-10(12)13/h1-2,4-5,10,14H,3,6-7H2 |
| InChIKey | AQUZQJWAOCHICH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|