C12H12F2N2O4S — CID 106030466
5-(aminomethyl)-N-[2-(difluoromethoxy)phenyl]furan-2-sulfonamide (PubChem CID 106030466) has the molecular formula C12H12F2N2O4S and a molecular weight of 318.30 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[2-(difluoromethoxy)phenyl]furan-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[2-(difluoromethoxy)phenyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106030466 |
| Molecular Formula | C12H12F2N2O4S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 5-(aminomethyl)-N-[2-(difluoromethoxy)phenyl]furan-2-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)Nc2ccccc2OC(F)F)o1 |
| InChI | InChI=1S/C12H12F2N2O4S/c13-12(14)20-10-4-2-1-3-9(10)16-21(17,18)11-6-5-8(7-15)19-11/h1-6,12,16H,7,15H2 |
| InChIKey | WIPRRMNSQFBDDM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |