C10H14ClNO4S2 — CID 43654272
3-chloro-N-(2-methylsulfonylphenyl)propane-1-sulfonamide (PubChem CID 43654272) has the molecular formula C10H14ClNO4S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 3-chloro-N-(2-methylsulfonylphenyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(2-methylsulfonylphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 43654272 |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 3-chloro-N-(2-methylsulfonylphenyl)propane-1-sulfonamide |
| SMILES | CS(=O)(=O)c1ccccc1NS(=O)(=O)CCCCl |
| InChI | InChI=1S/C10H14ClNO4S2/c1-17(13,14)10-6-3-2-5-9(10)12-18(15,16)8-4-7-11/h2-3,5-6,12H,4,7-8H2,1H3 |
| InChIKey | RTFUMICHPWCIMR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|