C10H14ClNO3S — CID 43653977
3-chloro-N-(2-methoxyphenyl)propane-1-sulfonamide (PubChem CID 43653977) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 3-chloro-N-(2-methoxyphenyl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(2-methoxyphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 43653977 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 3-chloro-N-(2-methoxyphenyl)propane-1-sulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)CCCCl |
| InChI | InChI=1S/C10H14ClNO3S/c1-15-10-6-3-2-5-9(10)12-16(13,14)8-4-7-11/h2-3,5-6,12H,4,7-8H2,1H3 |
| InChIKey | XYIPXYXDMBBXFM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|