C10H9ClN4O — CID 43699115
2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]acetamide (PubChem CID 43699115) has the molecular formula C10H9ClN4O and a molecular weight of 236.66 g/mol. Its IUPAC name is 2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 43699115 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccccc1-n1cncn1 |
| InChI | InChI=1S/C10H9ClN4O/c11-5-10(16)14-8-3-1-2-4-9(8)15-7-12-6-13-15/h1-4,6-7H,5H2,(H,14,16) |
| InChIKey | OQNCRYOAYBAPPQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|