C15H10BrClN4O — CID 55573291
5-bromo-2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]benzamide (PubChem CID 55573291) has the molecular formula C15H10BrClN4O and a molecular weight of 377.63 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55573291 |
| Molecular Formula | C15H10BrClN4O |
| Molecular Weight | 377.63 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 5-bromo-2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-n1cncn1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C15H10BrClN4O/c16-10-5-6-12(17)11(7-10)15(22)20-13-3-1-2-4-14(13)21-9-18-8-19-21/h1-9H,(H,20,22) |
| InChIKey | VDTVATIMOHVZPB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |