C19H15N5O — CID 134004270
2-methyl-N-[2-(1,2,4-triazol-1-yl)phenyl]quinoline-4-carboxamide (PubChem CID 134004270) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-methyl-N-[2-(1,2,4-triazol-1-yl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-methyl-N-[2-(1,2,4-triazol-1-yl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 134004270 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-methyl-N-[2-(1,2,4-triazol-1-yl)phenyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2-n2cncn2)c2ccccc2n1 |
| InChI | InChI=1S/C19H15N5O/c1-13-10-15(14-6-2-3-7-16(14)22-13)19(25)23-17-8-4-5-9-18(17)24-12-20-11-21-24/h2-12H,1H3,(H,23,25) |
| InChIKey | IXSSXAGPUXPRFU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |