C12H14N6O2 — CID 60847131
2-amino-N-[2-(1,2,4-triazol-1-yl)phenyl]butanediamide (PubChem CID 60847131) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-amino-N-[2-(1,2,4-triazol-1-yl)phenyl]butanediamide.
| Compound Name | 2-amino-N-[2-(1,2,4-triazol-1-yl)phenyl]butanediamide |
|---|---|
| PubChem CID | 60847131 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-amino-N-[2-(1,2,4-triazol-1-yl)phenyl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)Nc1ccccc1-n1cncn1 |
| InChI | InChI=1S/C12H14N6O2/c13-8(5-11(14)19)12(20)17-9-3-1-2-4-10(9)18-7-15-6-16-18/h1-4,6-8H,5,13H2,(H2,14,19)(H,17,20) |
| InChIKey | IXMXUMDPHMIPSJ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |