C12H9ClN4O2S2 — CID 35367955
5-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 35367955) has the molecular formula C12H9ClN4O2S2 and a molecular weight of 340.82 g/mol. Its IUPAC name is 5-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 35367955 |
| Molecular Formula | C12H9ClN4O2S2 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 5-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1-n1cncn1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H9ClN4O2S2/c13-11-5-6-12(20-11)21(18,19)16-9-3-1-2-4-10(9)17-8-14-7-15-17/h1-8,16H |
| InChIKey | LLTHVTNVCUOMNY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |