About N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide
N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide (PubChem CID 61253900) has the molecular formula C12H16N6O2S
and a molecular weight of 308.37 g/mol. Its IUPAC name is N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide |
| PubChem CID | 61253900 |
| Molecular Formula | C12H16N6O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1-n1cncn1)N1CCNCC1 |
| InChI | InChI=1S/C12H16N6O2S/c19-21(20,17-7-5-13-6-8-17)16-11-3-1-2-4-12(11)18-10-14-9-15-18/h1-4,9-10,13,16H,5-8H2 |
| InChIKey | NQEWYUKWEGVVDA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide?
The IUPAC name of N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide (CID 61253900) is N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide.
What is the SMILES notation for N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide?
The canonical SMILES for N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide is O=S(=O)(Nc1ccccc1-n1cncn1)N1CCNCC1.
What is the InChIKey of N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide?
The InChIKey is NQEWYUKWEGVVDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6O2S/c19-21(20,17-7-5-13-6-8-17)16-11-3-1-2-4-12(11)18-10-14-9-15-18/h1-4,9-10,13,16H,5-8H2.
What are the key properties of N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide?
N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide has a molecular weight of 308.37 g/mol, XLogP of -0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2,4-triazol-1-yl)phenyl]piperazine-1-sulfonamide is sourced from PubChem (CID 61253900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).