C14H11ClN4O2S — CID 35367970
2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]benzenesulfonamide (PubChem CID 35367970) has the molecular formula C14H11ClN4O2S and a molecular weight of 334.79 g/mol. Its IUPAC name is 2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35367970 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-chloro-N-[2-(1,2,4-triazol-1-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1-n1cncn1)c1ccccc1Cl |
| InChI | InChI=1S/C14H11ClN4O2S/c15-11-5-1-4-8-14(11)22(20,21)18-12-6-2-3-7-13(12)19-10-16-9-17-19/h1-10,18H |
| InChIKey | PQNPMNFJPGVKEE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |