C13H17ClN4O — CID 65337859
3-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-methylbutan-2-ol (PubChem CID 65337859) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is 3-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-methylbutan-2-ol.
| Compound Name | 3-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 65337859 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[5-chloro-2-(1,2,4-triazol-1-yl)anilino]-2-methylbutan-2-ol |
| SMILES | CC(Nc1cc(Cl)ccc1-n1cncn1)C(C)(C)O |
| InChI | InChI=1S/C13H17ClN4O/c1-9(13(2,3)19)17-11-6-10(14)4-5-12(11)18-8-15-7-16-18/h4-9,17,19H,1-3H3 |
| InChIKey | BQWJLAVLVCSEGR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |