C11H12ClN3 — CID 21023614
1-(4-chloro-2-propan-2-ylphenyl)-1,2,4-triazole (PubChem CID 21023614) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 1-(4-chloro-2-propan-2-ylphenyl)-1,2,4-triazole.
| Compound Name | 1-(4-chloro-2-propan-2-ylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 21023614 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-(4-chloro-2-propan-2-ylphenyl)-1,2,4-triazole |
| SMILES | CC(C)c1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C11H12ClN3/c1-8(2)10-5-9(12)3-4-11(10)15-7-13-6-14-15/h3-8H,1-2H3 |
| InChIKey | TUXKKEBZTYKFHK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |