C16H15ClN4 — CID 43226937
5-chloro-N-(1-phenylethyl)-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 43226937) has the molecular formula C16H15ClN4 and a molecular weight of 298.78 g/mol. Its IUPAC name is 5-chloro-N-(1-phenylethyl)-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 5-chloro-N-(1-phenylethyl)-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 43226937 |
| Molecular Formula | C16H15ClN4 |
| Molecular Weight | 298.78 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 5-chloro-N-(1-phenylethyl)-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | CC(Nc1cc(Cl)ccc1-n1cncn1)c1ccccc1 |
| InChI | InChI=1S/C16H15ClN4/c1-12(13-5-3-2-4-6-13)20-15-9-14(17)7-8-16(15)21-11-18-10-19-21/h2-12,20H,1H3 |
| InChIKey | BQFDTNSWTYLOBW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |