About 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol
2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol (PubChem CID 81412888) has the molecular formula C14H19ClN4O
and a molecular weight of 294.79 g/mol. Its IUPAC name is 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol.
Molecular Properties
| Compound Name | 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol |
| PubChem CID | 81412888 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol |
| SMILES | CCC(C)(CO)CNc1cc(Cl)ccc1-n1cncn1 |
| InChI | InChI=1S/C14H19ClN4O/c1-3-14(2,8-20)7-17-12-6-11(15)4-5-13(12)19-10-16-9-18-19/h4-6,9-10,17,20H,3,7-8H2,1-2H3 |
| InChIKey | JBQQQGFBXYKYKW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol?
The IUPAC name of 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol (CID 81412888) is 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol.
What is the SMILES notation for 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol?
The canonical SMILES for 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol is CCC(C)(CO)CNc1cc(Cl)ccc1-n1cncn1.
What is the InChIKey of 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol?
The InChIKey is JBQQQGFBXYKYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClN4O/c1-3-14(2,8-20)7-17-12-6-11(15)4-5-13(12)19-10-16-9-18-19/h4-6,9-10,17,20H,3,7-8H2,1-2H3.
What are the key properties of 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol?
2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol has a molecular weight of 294.79 g/mol, XLogP of 2.74, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-chloro-2-(1,2,4-triazol-1-yl)anilino]methyl]-2-methylbutan-1-ol is sourced from PubChem (CID 81412888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).