C17H18N4 — CID 43784452
N-[(3,4-dimethylphenyl)methyl]-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 43784452) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 43784452 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | Cc1ccc(CNc2ccccc2-n2cncn2)cc1C |
| InChI | InChI=1S/C17H18N4/c1-13-7-8-15(9-14(13)2)10-19-16-5-3-4-6-17(16)21-12-18-11-20-21/h3-9,11-12,19H,10H2,1-2H3 |
| InChIKey | BEFOPDODDINWHC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |