C13H19N5 — CID 61167520
N-hexyl-2-(1,2,4-triazol-1-yl)pyridin-3-amine (PubChem CID 61167520) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-hexyl-2-(1,2,4-triazol-1-yl)pyridin-3-amine.
| Compound Name | N-hexyl-2-(1,2,4-triazol-1-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 61167520 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-hexyl-2-(1,2,4-triazol-1-yl)pyridin-3-amine |
| SMILES | CCCCCCNc1cccnc1-n1cncn1 |
| InChI | InChI=1S/C13H19N5/c1-2-3-4-5-8-15-12-7-6-9-16-13(12)18-11-14-10-17-18/h6-7,9-11,15H,2-5,8H2,1H3 |
| InChIKey | DBOSZQSMCNRVBW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|