C15H22N6O2 — CID 60616709
1-(3-butoxypropyl)-3-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]urea (PubChem CID 60616709) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]urea.
| Compound Name | 1-(3-butoxypropyl)-3-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 60616709 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-(3-butoxypropyl)-3-[2-(1,2,4-triazol-1-yl)-3-pyridinyl]urea |
| SMILES | CCCCOCCCNC(=O)Nc1cccnc1-n1cncn1 |
| InChI | InChI=1S/C15H22N6O2/c1-2-3-9-23-10-5-8-18-15(22)20-13-6-4-7-17-14(13)21-12-16-11-19-21/h4,6-7,11-12H,2-3,5,8-10H2,1H3,(H2,18,20,22) |
| InChIKey | GFDGMPIJIHCSMT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|