C12H15ClN4 — CID 43726263
N-butyl-3-chloro-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 43726263) has the molecular formula C12H15ClN4 and a molecular weight of 250.73 g/mol. Its IUPAC name is N-butyl-3-chloro-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-butyl-3-chloro-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 43726263 |
| Molecular Formula | C12H15ClN4 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-butyl-3-chloro-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | CCCCNc1cccc(Cl)c1-n1cncn1 |
| InChI | InChI=1S/C12H15ClN4/c1-2-3-7-15-11-6-4-5-10(13)12(11)17-9-14-8-16-17/h4-6,8-9,15H,2-3,7H2,1H3 |
| InChIKey | ZWCROYJMOZTVJI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|